C17H18N4O3 — CID 3821685
15-amino-4,5-dimethoxy-10,14,16-triazatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6,12,14,16-hexaen-11-one (PubChem CID 3821685) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 15-amino-4,5-dimethoxy-10,14,16-triazatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6,12,14,16-hexaen-11-one.
| Compound Name | 15-amino-4,5-dimethoxy-10,14,16-triazatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6,12,14,16-hexaen-11-one |
|---|---|
| PubChem CID | 3821685 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 15-amino-4,5-dimethoxy-10,14,16-triazatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6,12,14,16-hexaen-11-one |
| SMILES | COc1cc2c(cc1OC)C1Cc3nc(N)ncc3C(=O)N1CC2 |
| InChI | InChI=1S/C17H18N4O3/c1-23-14-5-9-3-4-21-13(10(9)6-15(14)24-2)7-12-11(16(21)22)8-19-17(18)20-12/h5-6,8,13H,3-4,7H2,1-2H3,(H2,18,19,20) |
| InChIKey | PJKYNFVMJFLWCO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |