C16H14BrN3S — CID 3821769
1-[1-(4-bromophenyl)ethyl]-3-(3-cyanophenyl)thiourea (PubChem CID 3821769) has the molecular formula C16H14BrN3S and a molecular weight of 360.28 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)ethyl]-3-(3-cyanophenyl)thiourea.
| Compound Name | 1-[1-(4-bromophenyl)ethyl]-3-(3-cyanophenyl)thiourea |
|---|---|
| PubChem CID | 3821769 |
| Molecular Formula | C16H14BrN3S |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 1-[1-(4-bromophenyl)ethyl]-3-(3-cyanophenyl)thiourea |
| SMILES | CC(NC(=S)Nc1cccc(C#N)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H14BrN3S/c1-11(13-5-7-14(17)8-6-13)19-16(21)20-15-4-2-3-12(9-15)10-18/h2-9,11H,1H3,(H2,19,20,21) |
| InChIKey | PANFWSUVJKRXPA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|