C29H43N3O2 — CID 3821918
N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-2-(1-amino-3-methylbutyl)-1,3-oxazole-4-carboxamide (PubChem CID 3821918) has the molecular formula C29H43N3O2 and a molecular weight of 465.68 g/mol. Its IUPAC name is N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-2-(1-amino-3-methylbutyl)-1,3-oxazole-4-carboxamide.
| Compound Name | N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-2-(1-amino-3-methylbutyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3821918 |
| Molecular Formula | C29H43N3O2 |
| Molecular Weight | 465.68 g/mol |
| Exact Mass | 465.34 |
| IUPAC Name | N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-2-(1-amino-3-methylbutyl)-1,3-oxazole-4-carboxamide |
| SMILES | CC(C)CC(N)c1nc(C(=O)NCC2(C)CCCC3(C)c4ccc(C(C)C)cc4CCC23)co1 |
| InChI | InChI=1S/C29H43N3O2/c1-18(2)14-23(30)27-32-24(16-34-27)26(33)31-17-28(5)12-7-13-29(6)22-10-8-20(19(3)4)15-21(22)9-11-25(28)29/h8,10,15-16,18-19,23,25H,7,9,11-14,17,30H2,1-6H3,(H,31,33) |
| InChIKey | CMQFYKMSSDUXIE-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.68 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |