C18H17N5O4S — CID 3822074
[4-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]phenyl]sulfonylurea (PubChem CID 3822074) has the molecular formula C18H17N5O4S and a molecular weight of 399.43 g/mol. Its IUPAC name is [4-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]phenyl]sulfonylurea.
| Compound Name | [4-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]phenyl]sulfonylurea |
|---|---|
| PubChem CID | 3822074 |
| Molecular Formula | C18H17N5O4S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | [4-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]phenyl]sulfonylurea |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1/C=N/c1ccc(S(=O)(=O)NC(N)=O)cc1 |
| InChI | InChI=1S/C18H17N5O4S/c1-12-16(17(24)23(21-12)14-5-3-2-4-6-14)11-20-13-7-9-15(10-8-13)28(26,27)22-18(19)25/h2-11,21H,1H3,(H3,19,22,25)/b20-11+ |
| InChIKey | MLPKBGVPQKAYRA-RGVLZGJSSA-N |
| XLogP | 1.58 |
| TPSA | 139.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|