About 3,5-dithiophen-2-yl-1,2,4-triazol-4-amine
3,5-dithiophen-2-yl-1,2,4-triazol-4-amine (PubChem CID 3822215) has the molecular formula C10H8N4S2
and a molecular weight of 248.34 g/mol. Its IUPAC name is 3,5-dithiophen-2-yl-1,2,4-triazol-4-amine.
Molecular Properties
| Compound Name | 3,5-dithiophen-2-yl-1,2,4-triazol-4-amine |
| PubChem CID | 3822215 |
| Molecular Formula | C10H8N4S2 |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 3,5-dithiophen-2-yl-1,2,4-triazol-4-amine |
| SMILES | Nn1c(-c2cccs2)nnc1-c1cccs1 |
| InChI | InChI=1S/C10H8N4S2/c11-14-9(7-3-1-5-15-7)12-13-10(14)8-4-2-6-16-8/h1-6H,11H2 |
| InChIKey | QPJCHKDJMGRDEE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3,5-dithiophen-2-yl-1,2,4-triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dithiophen-2-yl-1,2,4-triazol-4-amine?
The IUPAC name of 3,5-dithiophen-2-yl-1,2,4-triazol-4-amine (CID 3822215) is 3,5-dithiophen-2-yl-1,2,4-triazol-4-amine.
What is the SMILES notation for 3,5-dithiophen-2-yl-1,2,4-triazol-4-amine?
The canonical SMILES for 3,5-dithiophen-2-yl-1,2,4-triazol-4-amine is Nn1c(-c2cccs2)nnc1-c1cccs1.
What is the InChIKey of 3,5-dithiophen-2-yl-1,2,4-triazol-4-amine?
The InChIKey is QPJCHKDJMGRDEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4S2/c11-14-9(7-3-1-5-15-7)12-13-10(14)8-4-2-6-16-8/h1-6H,11H2.
What are the key properties of 3,5-dithiophen-2-yl-1,2,4-triazol-4-amine?
3,5-dithiophen-2-yl-1,2,4-triazol-4-amine has a molecular weight of 248.34 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dithiophen-2-yl-1,2,4-triazol-4-amine is sourced from PubChem (CID 3822215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).