About 1-benzyltetrazole
1-benzyltetrazole (PubChem CID 3822426) has the molecular formula C8H8N4
and a molecular weight of 160.18 g/mol. Its IUPAC name is 1-benzyltetrazole.
Molecular Properties
| Compound Name | 1-benzyltetrazole |
| PubChem CID | 3822426 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 1-benzyltetrazole |
| SMILES | c1ccc(Cn2cnnn2)cc1 |
| InChI | InChI=1S/C8H8N4/c1-2-4-8(5-3-1)6-12-7-9-10-11-12/h1-5,7H,6H2 |
| InChIKey | AQBHAXPSOCMLGV-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzyltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyltetrazole?
The IUPAC name of 1-benzyltetrazole (CID 3822426) is 1-benzyltetrazole.
What is the SMILES notation for 1-benzyltetrazole?
The canonical SMILES for 1-benzyltetrazole is c1ccc(Cn2cnnn2)cc1.
What is the InChIKey of 1-benzyltetrazole?
The InChIKey is AQBHAXPSOCMLGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4/c1-2-4-8(5-3-1)6-12-7-9-10-11-12/h1-5,7H,6H2.
What are the key properties of 1-benzyltetrazole?
1-benzyltetrazole has a molecular weight of 160.18 g/mol, XLogP of 0.72, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyltetrazole is sourced from PubChem (CID 3822426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).