C13H11N3S — CID 3822673
5-(1H-indol-3-yl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole (PubChem CID 3822673) has the molecular formula C13H11N3S and a molecular weight of 241.32 g/mol. Its IUPAC name is 5-(1H-indol-3-yl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-(1H-indol-3-yl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 3822673 |
| Molecular Formula | C13H11N3S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 5-(1H-indol-3-yl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole |
| SMILES | c1ccc2c(-c3cnc4n3CCS4)c[nH]c2c1 |
| InChI | InChI=1S/C13H11N3S/c1-2-4-11-9(3-1)10(7-14-11)12-8-15-13-16(12)5-6-17-13/h1-4,7-8,14H,5-6H2 |
| InChIKey | XAOJXZQLPGGAKP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |