C19H22N2O2S — CID 3822912
N-[2-(cyclohexen-1-yl)ethyl]-5-oxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide (PubChem CID 3822912) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-5-oxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-5-oxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
|---|---|
| PubChem CID | 3822912 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-5-oxo-3,9b-dihydro-2H-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)C1CSC2c3ccccc3C(=O)N12 |
| InChI | InChI=1S/C19H22N2O2S/c22-17(20-11-10-13-6-2-1-3-7-13)16-12-24-19-15-9-5-4-8-14(15)18(23)21(16)19/h4-6,8-9,16,19H,1-3,7,10-12H2,(H,20,22) |
| InChIKey | CGUMVFFFHUDGGW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|