C15H13N3O2 — CID 3822987
N-(1,3-benzodioxol-5-ylmethyl)-1H-indazol-6-amine (PubChem CID 3822987) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-1H-indazol-6-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-1H-indazol-6-amine |
|---|---|
| PubChem CID | 3822987 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-1H-indazol-6-amine |
| SMILES | c1cc2c(cc1CNc1ccc3cn[nH]c3c1)OCO2 |
| InChI | InChI=1S/C15H13N3O2/c1-4-14-15(20-9-19-14)5-10(1)7-16-12-3-2-11-8-17-18-13(11)6-12/h1-6,8,16H,7,9H2,(H,17,18) |
| InChIKey | VGITVTJAMWUHQC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |