C22H20N2O8S — CID 3822992
methyl 2-[2-ethoxy-4-[[3-[(3-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 3822992) has the molecular formula C22H20N2O8S and a molecular weight of 472.48 g/mol. Its IUPAC name is methyl 2-[2-ethoxy-4-[[3-[(3-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-ethoxy-4-[[3-[(3-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 3822992 |
| Molecular Formula | C22H20N2O8S |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | methyl 2-[2-ethoxy-4-[[3-[(3-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOc1cc(C=C2SC(=O)N(Cc3cccc([N+](=O)[O-])c3)C2=O)ccc1OCC(=O)OC |
| InChI | InChI=1S/C22H20N2O8S/c1-3-31-18-10-14(7-8-17(18)32-13-20(25)30-2)11-19-21(26)23(22(27)33-19)12-15-5-4-6-16(9-15)24(28)29/h4-11H,3,12-13H2,1-2H3 |
| InChIKey | YDGLUSAZPXAMLM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|