C7H12N4O2 — CID 3823649
4-methyl-1,3,4,4a,5,6,8,8a-octahydropyrimido[4,5-d]pyrimidine-2,7-dione (PubChem CID 3823649) has the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. Its IUPAC name is 4-methyl-1,3,4,4a,5,6,8,8a-octahydropyrimido[4,5-d]pyrimidine-2,7-dione.
| Compound Name | 4-methyl-1,3,4,4a,5,6,8,8a-octahydropyrimido[4,5-d]pyrimidine-2,7-dione |
|---|---|
| PubChem CID | 3823649 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 4-methyl-1,3,4,4a,5,6,8,8a-octahydropyrimido[4,5-d]pyrimidine-2,7-dione |
| SMILES | CC1NC(=O)NC2NC(=O)NCC12 |
| InChI | InChI=1S/C7H12N4O2/c1-3-4-2-8-6(12)10-5(4)11-7(13)9-3/h3-5H,2H2,1H3,(H2,8,10,12)(H2,9,11,13) |
| InChIKey | CJNSZGMXFQQMOV-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |