C21H21N3O4 — CID 3823792
1-(3,5-dimethylphenyl)-5-[(4-ethoxyphenyl)iminomethyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 3823792) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-5-[(4-ethoxyphenyl)iminomethyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-(3,5-dimethylphenyl)-5-[(4-ethoxyphenyl)iminomethyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3823792 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-5-[(4-ethoxyphenyl)iminomethyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | CCOc1ccc(/N=C/c2c(O)n(-c3cc(C)cc(C)c3)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C21H21N3O4/c1-4-28-17-7-5-15(6-8-17)22-12-18-19(25)23-21(27)24(20(18)26)16-10-13(2)9-14(3)11-16/h5-12,26H,4H2,1-3H3,(H,23,25,27)/b22-12+ |
| InChIKey | SZINZBXZAREOIK-WSDLNYQXSA-N |
| XLogP | 3.00 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|