C24H32N4O6 — CID 3823818
1-hexyl-6-hydroxy-5-[(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)methyliminomethyl]pyrimidine-2,4-dione (PubChem CID 3823818) has the molecular formula C24H32N4O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is 1-hexyl-6-hydroxy-5-[(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)methyliminomethyl]pyrimidine-2,4-dione.
| Compound Name | 1-hexyl-6-hydroxy-5-[(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)methyliminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3823818 |
| Molecular Formula | C24H32N4O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 1-hexyl-6-hydroxy-5-[(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)methyliminomethyl]pyrimidine-2,4-dione |
| SMILES | CCCCCCn1c(O)c(/C=N/CC2c3c(cc4c(c3OC)OCO4)CCN2C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H32N4O6/c1-4-5-6-7-9-28-23(30)16(22(29)26-24(28)31)12-25-13-17-19-15(8-10-27(17)2)11-18-20(21(19)32-3)34-14-33-18/h11-12,17,30H,4-10,13-14H2,1-3H3,(H,26,29,31)/b25-12+ |
| InChIKey | HEZUUGPEVKPYLY-BRJLIKDPSA-N |
| XLogP | 2.21 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|