About [[1-[(2,6-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]amino] 3-(trifluoromethyl)benzoate
[[1-[(2,6-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]amino] 3-(trifluoromethyl)benzoate (PubChem CID 3823833) has the molecular formula C23H13Cl2F3N2O3
and a molecular weight of 493.27 g/mol. Its IUPAC name is [[1-[(2,6-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]amino] 3-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | [[1-[(2,6-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]amino] 3-(trifluoromethyl)benzoate |
| PubChem CID | 3823833 |
| Molecular Formula | C23H13Cl2F3N2O3 |
| Molecular Weight | 493.27 g/mol |
| Exact Mass | 492.03 |
| IUPAC Name | [[1-[(2,6-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]amino] 3-(trifluoromethyl)benzoate |
| SMILES | O=C(ON=C1C(=O)N(Cc2c(Cl)cccc2Cl)c2ccccc21)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H13Cl2F3N2O3/c24-17-8-4-9-18(25)16(17)12-30-19-10-2-1-7-15(19)20(21(30)31)29-33-22(32)13-5-3-6-14(11-13)23(26,27)28/h1-11H,12H2 |
| InChIKey | INCVBPGLOQVBDS-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.27 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[1-[(2,6-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]amino] 3-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[1-[(2,6-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]amino] 3-(trifluoromethyl)benzoate?
The IUPAC name of [[1-[(2,6-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]amino] 3-(trifluoromethyl)benzoate (CID 3823833) is [[1-[(2,6-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]amino] 3-(trifluoromethyl)benzoate.
What is the SMILES notation for [[1-[(2,6-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]amino] 3-(trifluoromethyl)benzoate?
The canonical SMILES for [[1-[(2,6-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]amino] 3-(trifluoromethyl)benzoate is O=C(ON=C1C(=O)N(Cc2c(Cl)cccc2Cl)c2ccccc21)c1cccc(C(F)(F)F)c1.
What is the InChIKey of [[1-[(2,6-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]amino] 3-(trifluoromethyl)benzoate?
The InChIKey is INCVBPGLOQVBDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H13Cl2F3N2O3/c24-17-8-4-9-18(25)16(17)12-30-19-10-2-1-7-15(19)20(21(30)31)29-33-22(32)13-5-3-6-14(11-13)23(26,27)28/h1-11H,12H2.
What are the key properties of [[1-[(2,6-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]amino] 3-(trifluoromethyl)benzoate?
[[1-[(2,6-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]amino] 3-(trifluoromethyl)benzoate has a molecular weight of 493.27 g/mol, XLogP of 6.12, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[1-[(2,6-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]amino] 3-(trifluoromethyl)benzoate is sourced from PubChem (CID 3823833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).