C19H15ClN2O4 — CID 38239776
methyl 2-chloro-5-[[2-(2-phenyl-1,3-oxazol-4-yl)acetyl]amino]benzoate (PubChem CID 38239776) has the molecular formula C19H15ClN2O4 and a molecular weight of 370.79 g/mol. Its IUPAC name is methyl 2-chloro-5-[[2-(2-phenyl-1,3-oxazol-4-yl)acetyl]amino]benzoate.
| Compound Name | methyl 2-chloro-5-[[2-(2-phenyl-1,3-oxazol-4-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 38239776 |
| Molecular Formula | C19H15ClN2O4 |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | methyl 2-chloro-5-[[2-(2-phenyl-1,3-oxazol-4-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)Cc2coc(-c3ccccc3)n2)ccc1Cl |
| InChI | InChI=1S/C19H15ClN2O4/c1-25-19(24)15-9-13(7-8-16(15)20)21-17(23)10-14-11-26-18(22-14)12-5-3-2-4-6-12/h2-9,11H,10H2,1H3,(H,21,23) |
| InChIKey | WGKROCBNJGQRHP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |