C8H4Cl2F7NO2S2 — CID 3824178
2,5-dichloro-N-(2,2,3,3,4,4,4-heptafluorobutyl)thiophene-3-sulfonamide (PubChem CID 3824178) has the molecular formula C8H4Cl2F7NO2S2 and a molecular weight of 414.15 g/mol. Its IUPAC name is 2,5-dichloro-N-(2,2,3,3,4,4,4-heptafluorobutyl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-(2,2,3,3,4,4,4-heptafluorobutyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 3824178 |
| Molecular Formula | C8H4Cl2F7NO2S2 |
| Molecular Weight | 414.15 g/mol |
| Exact Mass | 412.89 |
| IUPAC Name | 2,5-dichloro-N-(2,2,3,3,4,4,4-heptafluorobutyl)thiophene-3-sulfonamide |
| SMILES | O=S(=O)(NCC(F)(F)C(F)(F)C(F)(F)F)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C8H4Cl2F7NO2S2/c9-4-1-3(5(10)21-4)22(19,20)18-2-6(11,12)7(13,14)8(15,16)17/h1,18H,2H2 |
| InChIKey | NHNYSCKLYXRQQG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.15 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|