About 4-anilino-3-nitrobenzoic acid
4-anilino-3-nitrobenzoic acid (PubChem CID 3824366) has the molecular formula C13H10N2O4
and a molecular weight of 258.23 g/mol. Its IUPAC name is 4-anilino-3-nitrobenzoic acid.
Molecular Properties
| Compound Name | 4-anilino-3-nitrobenzoic acid |
| PubChem CID | 3824366 |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 4-anilino-3-nitrobenzoic acid |
| SMILES | O=C(O)c1ccc(Nc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H10N2O4/c16-13(17)9-6-7-11(12(8-9)15(18)19)14-10-4-2-1-3-5-10/h1-8,14H,(H,16,17) |
| InChIKey | UGUUCNPLYAGMNG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-anilino-3-nitrobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-anilino-3-nitrobenzoic acid?
The IUPAC name of 4-anilino-3-nitrobenzoic acid (CID 3824366) is 4-anilino-3-nitrobenzoic acid.
What is the SMILES notation for 4-anilino-3-nitrobenzoic acid?
The canonical SMILES for 4-anilino-3-nitrobenzoic acid is O=C(O)c1ccc(Nc2ccccc2)c([N+](=O)[O-])c1.
What is the InChIKey of 4-anilino-3-nitrobenzoic acid?
The InChIKey is UGUUCNPLYAGMNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O4/c16-13(17)9-6-7-11(12(8-9)15(18)19)14-10-4-2-1-3-5-10/h1-8,14H,(H,16,17).
What are the key properties of 4-anilino-3-nitrobenzoic acid?
4-anilino-3-nitrobenzoic acid has a molecular weight of 258.23 g/mol, XLogP of 3.04, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-anilino-3-nitrobenzoic acid is sourced from PubChem (CID 3824366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).