C27H34N2O6S — CID 3824973
3,4,6-trimethoxy-5,13-dimethyl-12-[(2,4,5-trimethoxy-3-methylphenyl)methylidene]-11,13-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-thione (PubChem CID 3824973) has the molecular formula C27H34N2O6S and a molecular weight of 514.64 g/mol. Its IUPAC name is 3,4,6-trimethoxy-5,13-dimethyl-12-[(2,4,5-trimethoxy-3-methylphenyl)methylidene]-11,13-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-thione.
| Compound Name | 3,4,6-trimethoxy-5,13-dimethyl-12-[(2,4,5-trimethoxy-3-methylphenyl)methylidene]-11,13-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-thione |
|---|---|
| PubChem CID | 3824973 |
| Molecular Formula | C27H34N2O6S |
| Molecular Weight | 514.64 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 3,4,6-trimethoxy-5,13-dimethyl-12-[(2,4,5-trimethoxy-3-methylphenyl)methylidene]-11,13-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-thione |
| SMILES | COc1cc(C=C2NC(=S)C3Cc4c(OC)c(C)c(OC)c(OC)c4C2N3C)c(OC)c(C)c1OC |
| InChI | InChI=1S/C27H34N2O6S/c1-13-22(31-5)15(11-19(30-4)24(13)33-7)10-17-21-20-16(12-18(29(21)3)27(36)28-17)23(32-6)14(2)25(34-8)26(20)35-9/h10-11,18,21H,12H2,1-9H3,(H,28,36) |
| InChIKey | VPEFRPWQRUAKGB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.64 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|