C18H20N2O3S — CID 38253884
N-benzyl-N-cyclopropyl-4-(methanesulfonamido)benzamide (PubChem CID 38253884) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is N-benzyl-N-cyclopropyl-4-(methanesulfonamido)benzamide.
| Compound Name | N-benzyl-N-cyclopropyl-4-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 38253884 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N-benzyl-N-cyclopropyl-4-(methanesulfonamido)benzamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)N(Cc2ccccc2)C2CC2)cc1 |
| InChI | InChI=1S/C18H20N2O3S/c1-24(22,23)19-16-9-7-15(8-10-16)18(21)20(17-11-12-17)13-14-5-3-2-4-6-14/h2-10,17,19H,11-13H2,1H3 |
| InChIKey | QULIESFEXYTULH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |