C25H20FNO3 — CID 3825479
3-benzyl-9-(3-fluorophenyl)-4-methyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one (PubChem CID 3825479) has the molecular formula C25H20FNO3 and a molecular weight of 401.44 g/mol. Its IUPAC name is 3-benzyl-9-(3-fluorophenyl)-4-methyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one.
| Compound Name | 3-benzyl-9-(3-fluorophenyl)-4-methyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
|---|---|
| PubChem CID | 3825479 |
| Molecular Formula | C25H20FNO3 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 3-benzyl-9-(3-fluorophenyl)-4-methyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
| SMILES | Cc1c(Cc2ccccc2)c(=O)oc2c3c(ccc12)OCN(c1cccc(F)c1)C3 |
| InChI | InChI=1S/C25H20FNO3/c1-16-20-10-11-23-22(14-27(15-29-23)19-9-5-8-18(26)13-19)24(20)30-25(28)21(16)12-17-6-3-2-4-7-17/h2-11,13H,12,14-15H2,1H3 |
| InChIKey | DBDYMBRDMNKNQG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|