C21H30N2O2 — CID 38256775
N-tert-butyl-4-[[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]amino]benzamide (PubChem CID 38256775) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is N-tert-butyl-4-[[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]amino]benzamide.
| Compound Name | N-tert-butyl-4-[[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 38256775 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | N-tert-butyl-4-[[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]amino]benzamide |
| SMILES | CC(C)=C[C@@H]1[C@H](C(=O)Nc2ccc(C(=O)NC(C)(C)C)cc2)C1(C)C |
| InChI | InChI=1S/C21H30N2O2/c1-13(2)12-16-17(21(16,6)7)19(25)22-15-10-8-14(9-11-15)18(24)23-20(3,4)5/h8-12,16-17H,1-7H3,(H,22,25)(H,23,24)/t16-,17-/m1/s1 |
| InChIKey | NUCDAUJKXVEABC-IAGOWNOFSA-N |
| XLogP | 4.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|