C18H17F3N2O2S — CID 3825946
N-(2-methylphenyl)-2-[(2,2,2-trifluoroacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 3825946) has the molecular formula C18H17F3N2O2S and a molecular weight of 382.41 g/mol. Its IUPAC name is N-(2-methylphenyl)-2-[(2,2,2-trifluoroacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-(2-methylphenyl)-2-[(2,2,2-trifluoroacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 3825946 |
| Molecular Formula | C18H17F3N2O2S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-(2-methylphenyl)-2-[(2,2,2-trifluoroacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1ccccc1NC(=O)c1c(NC(=O)C(F)(F)F)sc2c1CCCC2 |
| InChI | InChI=1S/C18H17F3N2O2S/c1-10-6-2-4-8-12(10)22-15(24)14-11-7-3-5-9-13(11)26-16(14)23-17(25)18(19,20)21/h2,4,6,8H,3,5,7,9H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | YAVAJABKDUUSRE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |