About 6-[[(3,4-dichlorophenyl)methylideneamino]-methylamino]-3-methyl-1H-pyrimidine-2,4-dione
6-[[(3,4-dichlorophenyl)methylideneamino]-methylamino]-3-methyl-1H-pyrimidine-2,4-dione (PubChem CID 3825968) has the molecular formula C13H12Cl2N4O2
and a molecular weight of 327.17 g/mol. Its IUPAC name is 6-[[(3,4-dichlorophenyl)methylideneamino]-methylamino]-3-methyl-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-[[(3,4-dichlorophenyl)methylideneamino]-methylamino]-3-methyl-1H-pyrimidine-2,4-dione |
| PubChem CID | 3825968 |
| Molecular Formula | C13H12Cl2N4O2 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 6-[[(3,4-dichlorophenyl)methylideneamino]-methylamino]-3-methyl-1H-pyrimidine-2,4-dione |
| SMILES | CN(N=Cc1ccc(Cl)c(Cl)c1)c1cc(=O)n(C)c(=O)[nH]1 |
| InChI | InChI=1S/C13H12Cl2N4O2/c1-18-12(20)6-11(17-13(18)21)19(2)16-7-8-3-4-9(14)10(15)5-8/h3-7H,1-2H3,(H,17,21) |
| InChIKey | MAGLLWKIDNWESD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[[(3,4-dichlorophenyl)methylideneamino]-methylamino]-3-methyl-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[(3,4-dichlorophenyl)methylideneamino]-methylamino]-3-methyl-1H-pyrimidine-2,4-dione?
The IUPAC name of 6-[[(3,4-dichlorophenyl)methylideneamino]-methylamino]-3-methyl-1H-pyrimidine-2,4-dione (CID 3825968) is 6-[[(3,4-dichlorophenyl)methylideneamino]-methylamino]-3-methyl-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 6-[[(3,4-dichlorophenyl)methylideneamino]-methylamino]-3-methyl-1H-pyrimidine-2,4-dione?
The canonical SMILES for 6-[[(3,4-dichlorophenyl)methylideneamino]-methylamino]-3-methyl-1H-pyrimidine-2,4-dione is CN(N=Cc1ccc(Cl)c(Cl)c1)c1cc(=O)n(C)c(=O)[nH]1.
What is the InChIKey of 6-[[(3,4-dichlorophenyl)methylideneamino]-methylamino]-3-methyl-1H-pyrimidine-2,4-dione?
The InChIKey is MAGLLWKIDNWESD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12Cl2N4O2/c1-18-12(20)6-11(17-13(18)21)19(2)16-7-8-3-4-9(14)10(15)5-8/h3-7H,1-2H3,(H,17,21).
What are the key properties of 6-[[(3,4-dichlorophenyl)methylideneamino]-methylamino]-3-methyl-1H-pyrimidine-2,4-dione?
6-[[(3,4-dichlorophenyl)methylideneamino]-methylamino]-3-methyl-1H-pyrimidine-2,4-dione has a molecular weight of 327.17 g/mol, XLogP of 1.85, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[(3,4-dichlorophenyl)methylideneamino]-methylamino]-3-methyl-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 3825968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).