C16H21FN2OS2 — CID 3825982
N-(3-butyl-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl)-1-(2-fluorophenyl)methanimine oxide (PubChem CID 3825982) has the molecular formula C16H21FN2OS2 and a molecular weight of 340.49 g/mol. Its IUPAC name is N-(3-butyl-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl)-1-(2-fluorophenyl)methanimine oxide.
| Compound Name | N-(3-butyl-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl)-1-(2-fluorophenyl)methanimine oxide |
|---|---|
| PubChem CID | 3825982 |
| Molecular Formula | C16H21FN2OS2 |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N-(3-butyl-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl)-1-(2-fluorophenyl)methanimine oxide |
| SMILES | CCCCN1C(=S)SC(C)(C)C1[N+]([O-])=Cc1ccccc1F |
| InChI | InChI=1S/C16H21FN2OS2/c1-4-5-10-18-14(16(2,3)22-15(18)21)19(20)11-12-8-6-7-9-13(12)17/h6-9,11,14H,4-5,10H2,1-3H3 |
| InChIKey | SMGBVEFRSSVHRG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|