C15H17N5O2S — CID 38263518
2-[4-[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]piperazin-1-yl]pyridine-4-carbonitrile (PubChem CID 38263518) has the molecular formula C15H17N5O2S and a molecular weight of 331.40 g/mol. Its IUPAC name is 2-[4-[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]piperazin-1-yl]pyridine-4-carbonitrile.
| Compound Name | 2-[4-[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]piperazin-1-yl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 38263518 |
| Molecular Formula | C15H17N5O2S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-[4-[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]piperazin-1-yl]pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(N2CCN(C(=O)CN3CCSC3=O)CC2)c1 |
| InChI | InChI=1S/C15H17N5O2S/c16-10-12-1-2-17-13(9-12)18-3-5-19(6-4-18)14(21)11-20-7-8-23-15(20)22/h1-2,9H,3-8,11H2 |
| InChIKey | WRMQWOXDBVWWEI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 80.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|