About 8-methyl-5H-[1,2,4]triazolo[4,3-b]pyridazin-6-one
8-methyl-5H-[1,2,4]triazolo[4,3-b]pyridazin-6-one (PubChem CID 3826397) has the molecular formula C6H6N4O
and a molecular weight of 150.14 g/mol. Its IUPAC name is 8-methyl-5H-[1,2,4]triazolo[4,3-b]pyridazin-6-one.
Analyze 8-methyl-5H-[1,2,4]triazolo[4,3-b]pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-5H-[1,2,4]triazolo[4,3-b]pyridazin-6-one?
The IUPAC name of 8-methyl-5H-[1,2,4]triazolo[4,3-b]pyridazin-6-one (CID 3826397) is 8-methyl-5H-[1,2,4]triazolo[4,3-b]pyridazin-6-one.
What is the SMILES notation for 8-methyl-5H-[1,2,4]triazolo[4,3-b]pyridazin-6-one?
The canonical SMILES for 8-methyl-5H-[1,2,4]triazolo[4,3-b]pyridazin-6-one is Cc1cc(=O)[nH]n2cnnc12.
What is the InChIKey of 8-methyl-5H-[1,2,4]triazolo[4,3-b]pyridazin-6-one?
The InChIKey is FIRVTVFDFAMKQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O/c1-4-2-5(11)9-10-3-7-8-6(4)10/h2-3H,1H3,(H,9,11).
What are the key properties of 8-methyl-5H-[1,2,4]triazolo[4,3-b]pyridazin-6-one?
8-methyl-5H-[1,2,4]triazolo[4,3-b]pyridazin-6-one has a molecular weight of 150.14 g/mol, XLogP of -0.27, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-5H-[1,2,4]triazolo[4,3-b]pyridazin-6-one is sourced from PubChem (CID 3826397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).