C20H20IN5 — CID 3827063
2-N-benzyl-4-N-[1-(4-iodophenyl)ethylideneamino]-6-methylpyrimidine-2,4-diamine (PubChem CID 3827063) has the molecular formula C20H20IN5 and a molecular weight of 457.32 g/mol. Its IUPAC name is 2-N-benzyl-4-N-[1-(4-iodophenyl)ethylideneamino]-6-methylpyrimidine-2,4-diamine.
| Compound Name | 2-N-benzyl-4-N-[1-(4-iodophenyl)ethylideneamino]-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 3827063 |
| Molecular Formula | C20H20IN5 |
| Molecular Weight | 457.32 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 2-N-benzyl-4-N-[1-(4-iodophenyl)ethylideneamino]-6-methylpyrimidine-2,4-diamine |
| SMILES | CC(=NNc1cc(C)nc(NCc2ccccc2)n1)c1ccc(I)cc1 |
| InChI | InChI=1S/C20H20IN5/c1-14-12-19(26-25-15(2)17-8-10-18(21)11-9-17)24-20(23-14)22-13-16-6-4-3-5-7-16/h3-12H,13H2,1-2H3,(H2,22,23,24,26) |
| InChIKey | SJQYAOLOVGVSFL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.32 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|