C19H22F2N4O — CID 38272106
1-(2-fluorophenyl)-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]urea (PubChem CID 38272106) has the molecular formula C19H22F2N4O and a molecular weight of 360.41 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]urea.
| Compound Name | 1-(2-fluorophenyl)-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]urea |
|---|---|
| PubChem CID | 38272106 |
| Molecular Formula | C19H22F2N4O |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]urea |
| SMILES | O=C(NCCN1CCN(c2ccc(F)cc2)CC1)Nc1ccccc1F |
| InChI | InChI=1S/C19H22F2N4O/c20-15-5-7-16(8-6-15)25-13-11-24(12-14-25)10-9-22-19(26)23-18-4-2-1-3-17(18)21/h1-8H,9-14H2,(H2,22,23,26) |
| InChIKey | YJLWLFKNPXHIIH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |