About N-(3-benzyl-1,3-thiazol-2-ylidene)-3-methyl-1,2-oxazole-5-carboxamide
N-(3-benzyl-1,3-thiazol-2-ylidene)-3-methyl-1,2-oxazole-5-carboxamide (PubChem CID 38272852) has the molecular formula C15H13N3O2S
and a molecular weight of 299.36 g/mol. Its IUPAC name is N-(3-benzyl-1,3-thiazol-2-ylidene)-3-methyl-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(3-benzyl-1,3-thiazol-2-ylidene)-3-methyl-1,2-oxazole-5-carboxamide |
| PubChem CID | 38272852 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | N-(3-benzyl-1,3-thiazol-2-ylidene)-3-methyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(C(=O)/N=c2\sccn2Cc2ccccc2)on1 |
| InChI | InChI=1S/C15H13N3O2S/c1-11-9-13(20-17-11)14(19)16-15-18(7-8-21-15)10-12-5-3-2-4-6-12/h2-9H,10H2,1H3/b16-15- |
| InChIKey | YJRMOHFOTSFAKP-NXVVXOECSA-N |
| XLogP | 2.64 |
| TPSA | 60.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-benzyl-1,3-thiazol-2-ylidene)-3-methyl-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-benzyl-1,3-thiazol-2-ylidene)-3-methyl-1,2-oxazole-5-carboxamide?
The IUPAC name of N-(3-benzyl-1,3-thiazol-2-ylidene)-3-methyl-1,2-oxazole-5-carboxamide (CID 38272852) is N-(3-benzyl-1,3-thiazol-2-ylidene)-3-methyl-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N-(3-benzyl-1,3-thiazol-2-ylidene)-3-methyl-1,2-oxazole-5-carboxamide?
The canonical SMILES for N-(3-benzyl-1,3-thiazol-2-ylidene)-3-methyl-1,2-oxazole-5-carboxamide is Cc1cc(C(=O)/N=c2\sccn2Cc2ccccc2)on1.
What is the InChIKey of N-(3-benzyl-1,3-thiazol-2-ylidene)-3-methyl-1,2-oxazole-5-carboxamide?
The InChIKey is YJRMOHFOTSFAKP-NXVVXOECSA-N. The full InChI is InChI=1S/C15H13N3O2S/c1-11-9-13(20-17-11)14(19)16-15-18(7-8-21-15)10-12-5-3-2-4-6-12/h2-9H,10H2,1H3/b16-15-.
What are the key properties of N-(3-benzyl-1,3-thiazol-2-ylidene)-3-methyl-1,2-oxazole-5-carboxamide?
N-(3-benzyl-1,3-thiazol-2-ylidene)-3-methyl-1,2-oxazole-5-carboxamide has a molecular weight of 299.36 g/mol, XLogP of 2.64, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-benzyl-1,3-thiazol-2-ylidene)-3-methyl-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 38272852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).