C21H21FN2O2S — CID 3828220
3-benzyl-8-[(4-fluorophenyl)methylsulfanyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 3828220) has the molecular formula C21H21FN2O2S and a molecular weight of 384.48 g/mol. Its IUPAC name is 3-benzyl-8-[(4-fluorophenyl)methylsulfanyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | 3-benzyl-8-[(4-fluorophenyl)methylsulfanyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 3828220 |
| Molecular Formula | C21H21FN2O2S |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 3-benzyl-8-[(4-fluorophenyl)methylsulfanyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | O=C1NC(Cc2ccccc2)C(=O)N2CCC(SCc3ccc(F)cc3)C12 |
| InChI | InChI=1S/C21H21FN2O2S/c22-16-8-6-15(7-9-16)13-27-18-10-11-24-19(18)20(25)23-17(21(24)26)12-14-4-2-1-3-5-14/h1-9,17-19H,10-13H2,(H,23,25) |
| InChIKey | DCYIFORSZNSSFQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |