About benzyl hex-2-enoate
benzyl hex-2-enoate (PubChem CID 3828590) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is benzyl hex-2-enoate.
Molecular Properties
| Compound Name | benzyl hex-2-enoate |
| PubChem CID | 3828590 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | benzyl hex-2-enoate |
| SMILES | CCCC=CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H16O2/c1-2-3-5-10-13(14)15-11-12-8-6-4-7-9-12/h4-10H,2-3,11H2,1H3 |
| InChIKey | DLYYFHZPEQEPLG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze benzyl hex-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl hex-2-enoate?
The IUPAC name of benzyl hex-2-enoate (CID 3828590) is benzyl hex-2-enoate.
What is the SMILES notation for benzyl hex-2-enoate?
The canonical SMILES for benzyl hex-2-enoate is CCCC=CC(=O)OCc1ccccc1.
What is the InChIKey of benzyl hex-2-enoate?
The InChIKey is DLYYFHZPEQEPLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2/c1-2-3-5-10-13(14)15-11-12-8-6-4-7-9-12/h4-10H,2-3,11H2,1H3.
What are the key properties of benzyl hex-2-enoate?
benzyl hex-2-enoate has a molecular weight of 204.27 g/mol, XLogP of 3.09, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl hex-2-enoate is sourced from PubChem (CID 3828590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).