C14H12ClN3O4 — CID 3828810
methyl 7-(4-chlorophenyl)-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate (PubChem CID 3828810) has the molecular formula C14H12ClN3O4 and a molecular weight of 321.72 g/mol. Its IUPAC name is methyl 7-(4-chlorophenyl)-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate.
| Compound Name | methyl 7-(4-chlorophenyl)-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 3828810 |
| Molecular Formula | C14H12ClN3O4 |
| Molecular Weight | 321.72 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | methyl 7-(4-chlorophenyl)-6,8-dioxo-1,2,7-triazaspiro[4.4]non-2-ene-3-carboxylate |
| SMILES | COC(=O)C1=NNC2(CC(=O)N(c3ccc(Cl)cc3)C2=O)C1 |
| InChI | InChI=1S/C14H12ClN3O4/c1-22-12(20)10-6-14(17-16-10)7-11(19)18(13(14)21)9-4-2-8(15)3-5-9/h2-5,17H,6-7H2,1H3 |
| InChIKey | ZRRPDEBQUBBBAS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.72 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|