About 2,2-bis(chloromethyl)-1,3-dioxane
2,2-bis(chloromethyl)-1,3-dioxane (PubChem CID 3829870) has the molecular formula C6H10Cl2O2
and a molecular weight of 185.05 g/mol. Its IUPAC name is 2,2-bis(chloromethyl)-1,3-dioxane.
Molecular Properties
| Compound Name | 2,2-bis(chloromethyl)-1,3-dioxane |
| PubChem CID | 3829870 |
| Molecular Formula | C6H10Cl2O2 |
| Molecular Weight | 185.05 g/mol |
| Exact Mass | 184.01 |
| IUPAC Name | 2,2-bis(chloromethyl)-1,3-dioxane |
| SMILES | ClCC1(CCl)OCCCO1 |
| InChI | InChI=1S/C6H10Cl2O2/c7-4-6(5-8)9-2-1-3-10-6/h1-5H2 |
| InChIKey | JCRPRRSNULCPGB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.05 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(chloromethyl)-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(chloromethyl)-1,3-dioxane?
The IUPAC name of 2,2-bis(chloromethyl)-1,3-dioxane (CID 3829870) is 2,2-bis(chloromethyl)-1,3-dioxane.
What is the SMILES notation for 2,2-bis(chloromethyl)-1,3-dioxane?
The canonical SMILES for 2,2-bis(chloromethyl)-1,3-dioxane is ClCC1(CCl)OCCCO1.
What is the InChIKey of 2,2-bis(chloromethyl)-1,3-dioxane?
The InChIKey is JCRPRRSNULCPGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10Cl2O2/c7-4-6(5-8)9-2-1-3-10-6/h1-5H2.
What are the key properties of 2,2-bis(chloromethyl)-1,3-dioxane?
2,2-bis(chloromethyl)-1,3-dioxane has a molecular weight of 185.05 g/mol, XLogP of 1.60, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(chloromethyl)-1,3-dioxane is sourced from PubChem (CID 3829870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).