C19H15N3O — CID 3830531
2-amino-5-methyl-4-phenyl-4H-pyrano[3,2-b]indole-3-carbonitrile (PubChem CID 3830531) has the molecular formula C19H15N3O and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-amino-5-methyl-4-phenyl-4H-pyrano[3,2-b]indole-3-carbonitrile.
| Compound Name | 2-amino-5-methyl-4-phenyl-4H-pyrano[3,2-b]indole-3-carbonitrile |
|---|---|
| PubChem CID | 3830531 |
| Molecular Formula | C19H15N3O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-amino-5-methyl-4-phenyl-4H-pyrano[3,2-b]indole-3-carbonitrile |
| SMILES | Cn1c2c(c3ccccc31)OC(N)=C(C#N)C2c1ccccc1 |
| InChI | InChI=1S/C19H15N3O/c1-22-15-10-6-5-9-13(15)18-17(22)16(12-7-3-2-4-8-12)14(11-20)19(21)23-18/h2-10,16H,21H2,1H3 |
| InChIKey | UDHBPXSTYFIPOR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 63.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |