About 9-phenyl-6,8-bis(sulfanylidene)-3,7-dihydropurin-2-one
9-phenyl-6,8-bis(sulfanylidene)-3,7-dihydropurin-2-one (PubChem CID 3830630) has the molecular formula C11H8N4OS2
and a molecular weight of 276.35 g/mol. Its IUPAC name is 9-phenyl-6,8-bis(sulfanylidene)-3,7-dihydropurin-2-one.
Molecular Properties
| Compound Name | 9-phenyl-6,8-bis(sulfanylidene)-3,7-dihydropurin-2-one |
| PubChem CID | 3830630 |
| Molecular Formula | C11H8N4OS2 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 9-phenyl-6,8-bis(sulfanylidene)-3,7-dihydropurin-2-one |
| SMILES | O=c1[nH]c(=S)c2[nH]c(=S)n(-c3ccccc3)c2[nH]1 |
| InChI | InChI=1S/C11H8N4OS2/c16-10-13-8-7(9(17)14-10)12-11(18)15(8)6-4-2-1-3-5-6/h1-5H,(H,12,18)(H2,13,14,16,17) |
| InChIKey | AGSYBUUGFHZGBE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 9-phenyl-6,8-bis(sulfanylidene)-3,7-dihydropurin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-phenyl-6,8-bis(sulfanylidene)-3,7-dihydropurin-2-one?
The IUPAC name of 9-phenyl-6,8-bis(sulfanylidene)-3,7-dihydropurin-2-one (CID 3830630) is 9-phenyl-6,8-bis(sulfanylidene)-3,7-dihydropurin-2-one.
What is the SMILES notation for 9-phenyl-6,8-bis(sulfanylidene)-3,7-dihydropurin-2-one?
The canonical SMILES for 9-phenyl-6,8-bis(sulfanylidene)-3,7-dihydropurin-2-one is O=c1[nH]c(=S)c2[nH]c(=S)n(-c3ccccc3)c2[nH]1.
What is the InChIKey of 9-phenyl-6,8-bis(sulfanylidene)-3,7-dihydropurin-2-one?
The InChIKey is AGSYBUUGFHZGBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4OS2/c16-10-13-8-7(9(17)14-10)12-11(18)15(8)6-4-2-1-3-5-6/h1-5H,(H,12,18)(H2,13,14,16,17).
What are the key properties of 9-phenyl-6,8-bis(sulfanylidene)-3,7-dihydropurin-2-one?
9-phenyl-6,8-bis(sulfanylidene)-3,7-dihydropurin-2-one has a molecular weight of 276.35 g/mol, XLogP of 2.43, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-phenyl-6,8-bis(sulfanylidene)-3,7-dihydropurin-2-one is sourced from PubChem (CID 3830630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).