C25H15ClN4O4S — CID 3831179
N-(4-chlorophenyl)-2-cyano-2-[5-[(3-nitrophenyl)methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide (PubChem CID 3831179) has the molecular formula C25H15ClN4O4S and a molecular weight of 502.94 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-cyano-2-[5-[(3-nitrophenyl)methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-cyano-2-[5-[(3-nitrophenyl)methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide |
|---|---|
| PubChem CID | 3831179 |
| Molecular Formula | C25H15ClN4O4S |
| Molecular Weight | 502.94 g/mol |
| Exact Mass | 502.05 |
| IUPAC Name | N-(4-chlorophenyl)-2-cyano-2-[5-[(3-nitrophenyl)methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]acetamide |
| SMILES | N#CC(C(=O)Nc1ccc(Cl)cc1)=c1sc(=Cc2cccc([N+](=O)[O-])c2)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C25H15ClN4O4S/c26-17-9-11-18(12-10-17)28-23(31)21(15-27)25-29(19-6-2-1-3-7-19)24(32)22(35-25)14-16-5-4-8-20(13-16)30(33)34/h1-14H,(H,28,31) |
| InChIKey | UBEXNFITUOPXJV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 118.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.94 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|