C14H18N4O — CID 38312923
2-cyclohexyl-N-([1,2,4]triazolo[4,3-a]pyridin-3-yl)acetamide (PubChem CID 38312923) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-cyclohexyl-N-([1,2,4]triazolo[4,3-a]pyridin-3-yl)acetamide.
| Compound Name | 2-cyclohexyl-N-([1,2,4]triazolo[4,3-a]pyridin-3-yl)acetamide |
|---|---|
| PubChem CID | 38312923 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2-cyclohexyl-N-([1,2,4]triazolo[4,3-a]pyridin-3-yl)acetamide |
| SMILES | O=C(CC1CCCCC1)Nc1nnc2ccccn12 |
| InChI | InChI=1S/C14H18N4O/c19-13(10-11-6-2-1-3-7-11)15-14-17-16-12-8-4-5-9-18(12)14/h4-5,8-9,11H,1-3,6-7,10H2,(H,15,17,19) |
| InChIKey | ZIVYRILXYWRFKK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |