C21H22N2O9 — CID 3832418
3-O'-(2-methoxyethyl) 5-O'-methyl 2'-amino-6'-(2-methoxy-2-oxoethyl)-2-oxospiro[1H-indole-3,4'-pyran]-3',5'-dicarboxylate (PubChem CID 3832418) has the molecular formula C21H22N2O9 and a molecular weight of 446.41 g/mol. Its IUPAC name is 3-O'-(2-methoxyethyl) 5-O'-methyl 2'-amino-6'-(2-methoxy-2-oxoethyl)-2-oxospiro[1H-indole-3,4'-pyran]-3',5'-dicarboxylate.
| Compound Name | 3-O'-(2-methoxyethyl) 5-O'-methyl 2'-amino-6'-(2-methoxy-2-oxoethyl)-2-oxospiro[1H-indole-3,4'-pyran]-3',5'-dicarboxylate |
|---|---|
| PubChem CID | 3832418 |
| Molecular Formula | C21H22N2O9 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 3-O'-(2-methoxyethyl) 5-O'-methyl 2'-amino-6'-(2-methoxy-2-oxoethyl)-2-oxospiro[1H-indole-3,4'-pyran]-3',5'-dicarboxylate |
| SMILES | COCCOC(=O)C1=C(N)OC(CC(=O)OC)=C(C(=O)OC)C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C21H22N2O9/c1-28-8-9-31-19(26)16-17(22)32-13(10-14(24)29-2)15(18(25)30-3)21(16)11-6-4-5-7-12(11)23-20(21)27/h4-7H,8-10,22H2,1-3H3,(H,23,27) |
| InChIKey | LFOXYGOHYUCZKB-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 152.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|