About 3-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]pyrazole
3-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]pyrazole (PubChem CID 3832516) has the molecular formula C13H12Cl2N2
and a molecular weight of 267.16 g/mol. Its IUPAC name is 3-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]pyrazole.
Molecular Properties
| Compound Name | 3-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]pyrazole |
| PubChem CID | 3832516 |
| Molecular Formula | C13H12Cl2N2 |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 3-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]pyrazole |
| SMILES | Clc1cccc(Cl)c1Cn1ccc(C2CC2)n1 |
| InChI | InChI=1S/C13H12Cl2N2/c14-11-2-1-3-12(15)10(11)8-17-7-6-13(16-17)9-4-5-9/h1-3,6-7,9H,4-5,8H2 |
| InChIKey | VEZDWISOSWOBQD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]pyrazole?
The IUPAC name of 3-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]pyrazole (CID 3832516) is 3-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]pyrazole.
What is the SMILES notation for 3-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]pyrazole?
The canonical SMILES for 3-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]pyrazole is Clc1cccc(Cl)c1Cn1ccc(C2CC2)n1.
What is the InChIKey of 3-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]pyrazole?
The InChIKey is VEZDWISOSWOBQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12Cl2N2/c14-11-2-1-3-12(15)10(11)8-17-7-6-13(16-17)9-4-5-9/h1-3,6-7,9H,4-5,8H2.
What are the key properties of 3-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]pyrazole?
3-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]pyrazole has a molecular weight of 267.16 g/mol, XLogP of 4.12, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-1-[(2,6-dichlorophenyl)methyl]pyrazole is sourced from PubChem (CID 3832516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).