About 3-(5-hydroxy-4,4-dimethylpentyl)-2-pentan-3-yl-1,3-thiazolidin-4-one
3-(5-hydroxy-4,4-dimethylpentyl)-2-pentan-3-yl-1,3-thiazolidin-4-one (PubChem CID 3832794) has the molecular formula C15H29NO2S
and a molecular weight of 287.47 g/mol. Its IUPAC name is 3-(5-hydroxy-4,4-dimethylpentyl)-2-pentan-3-yl-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 3-(5-hydroxy-4,4-dimethylpentyl)-2-pentan-3-yl-1,3-thiazolidin-4-one |
| PubChem CID | 3832794 |
| Molecular Formula | C15H29NO2S |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 3-(5-hydroxy-4,4-dimethylpentyl)-2-pentan-3-yl-1,3-thiazolidin-4-one |
| SMILES | CCC(CC)C1SCC(=O)N1CCCC(C)(C)CO |
| InChI | InChI=1S/C15H29NO2S/c1-5-12(6-2)14-16(13(18)10-19-14)9-7-8-15(3,4)11-17/h12,14,17H,5-11H2,1-4H3 |
| InChIKey | JEEKVFXYFPYQDH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5-hydroxy-4,4-dimethylpentyl)-2-pentan-3-yl-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-hydroxy-4,4-dimethylpentyl)-2-pentan-3-yl-1,3-thiazolidin-4-one?
The IUPAC name of 3-(5-hydroxy-4,4-dimethylpentyl)-2-pentan-3-yl-1,3-thiazolidin-4-one (CID 3832794) is 3-(5-hydroxy-4,4-dimethylpentyl)-2-pentan-3-yl-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-(5-hydroxy-4,4-dimethylpentyl)-2-pentan-3-yl-1,3-thiazolidin-4-one?
The canonical SMILES for 3-(5-hydroxy-4,4-dimethylpentyl)-2-pentan-3-yl-1,3-thiazolidin-4-one is CCC(CC)C1SCC(=O)N1CCCC(C)(C)CO.
What is the InChIKey of 3-(5-hydroxy-4,4-dimethylpentyl)-2-pentan-3-yl-1,3-thiazolidin-4-one?
The InChIKey is JEEKVFXYFPYQDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO2S/c1-5-12(6-2)14-16(13(18)10-19-14)9-7-8-15(3,4)11-17/h12,14,17H,5-11H2,1-4H3.
What are the key properties of 3-(5-hydroxy-4,4-dimethylpentyl)-2-pentan-3-yl-1,3-thiazolidin-4-one?
3-(5-hydroxy-4,4-dimethylpentyl)-2-pentan-3-yl-1,3-thiazolidin-4-one has a molecular weight of 287.47 g/mol, XLogP of 3.12, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-hydroxy-4,4-dimethylpentyl)-2-pentan-3-yl-1,3-thiazolidin-4-one is sourced from PubChem (CID 3832794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).