C24H17N3O3 — CID 3832882
2-phenyl-4-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methylidene]-1,3-oxazolidin-5-one (PubChem CID 3832882) has the molecular formula C24H17N3O3 and a molecular weight of 395.42 g/mol. Its IUPAC name is 2-phenyl-4-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methylidene]-1,3-oxazolidin-5-one.
| Compound Name | 2-phenyl-4-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methylidene]-1,3-oxazolidin-5-one |
|---|---|
| PubChem CID | 3832882 |
| Molecular Formula | C24H17N3O3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 2-phenyl-4-[[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]methylidene]-1,3-oxazolidin-5-one |
| SMILES | O=C1OC(c2ccccc2)NC1=Cc1ccc(-c2nnc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C24H17N3O3/c28-24-20(25-21(30-24)17-7-3-1-4-8-17)15-16-11-13-19(14-12-16)23-27-26-22(29-23)18-9-5-2-6-10-18/h1-15,21,25H |
| InChIKey | BTZPADHWHWUYKP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|