C18H17FN2O3 — CID 3833807
N-tert-butyl-7-fluoro-2-methyl-5-oxochromeno[2,3-b]pyridine-3-carboxamide (PubChem CID 3833807) has the molecular formula C18H17FN2O3 and a molecular weight of 328.34 g/mol. Its IUPAC name is N-tert-butyl-7-fluoro-2-methyl-5-oxochromeno[2,3-b]pyridine-3-carboxamide.
| Compound Name | N-tert-butyl-7-fluoro-2-methyl-5-oxochromeno[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3833807 |
| Molecular Formula | C18H17FN2O3 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-tert-butyl-7-fluoro-2-methyl-5-oxochromeno[2,3-b]pyridine-3-carboxamide |
| SMILES | Cc1nc2oc3ccc(F)cc3c(=O)c2cc1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H17FN2O3/c1-9-11(16(23)21-18(2,3)4)8-13-15(22)12-7-10(19)5-6-14(12)24-17(13)20-9/h5-8H,1-4H3,(H,21,23) |
| InChIKey | LENJMGNMKSEHTD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|