C18H14ClFN2S — CID 3834083
4-(2-chloro-6-fluorophenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazoline-2-thione (PubChem CID 3834083) has the molecular formula C18H14ClFN2S and a molecular weight of 344.84 g/mol. Its IUPAC name is 4-(2-chloro-6-fluorophenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazoline-2-thione.
| Compound Name | 4-(2-chloro-6-fluorophenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazoline-2-thione |
|---|---|
| PubChem CID | 3834083 |
| Molecular Formula | C18H14ClFN2S |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 4-(2-chloro-6-fluorophenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazoline-2-thione |
| SMILES | Fc1cccc(Cl)c1C1NC(=S)NC2=C1CCc1ccccc12 |
| InChI | InChI=1S/C18H14ClFN2S/c19-13-6-3-7-14(20)15(13)17-12-9-8-10-4-1-2-5-11(10)16(12)21-18(23)22-17/h1-7,17H,8-9H2,(H2,21,22,23) |
| InChIKey | OHFUGXXBNSPDOQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|