C18H20N2O3 — CID 3835157
1-[1-[(3,4-dimethoxyphenyl)methyl]benzimidazol-2-yl]ethanol (PubChem CID 3835157) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-[1-[(3,4-dimethoxyphenyl)methyl]benzimidazol-2-yl]ethanol.
| Compound Name | 1-[1-[(3,4-dimethoxyphenyl)methyl]benzimidazol-2-yl]ethanol |
|---|---|
| PubChem CID | 3835157 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 1-[1-[(3,4-dimethoxyphenyl)methyl]benzimidazol-2-yl]ethanol |
| SMILES | COc1ccc(Cn2c(C(C)O)nc3ccccc32)cc1OC |
| InChI | InChI=1S/C18H20N2O3/c1-12(21)18-19-14-6-4-5-7-15(14)20(18)11-13-8-9-16(22-2)17(10-13)23-3/h4-10,12,21H,11H2,1-3H3 |
| InChIKey | QSXJTYMXIOKRIH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |