About N-[2-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]-3-(trifluoromethyl)benzamide
N-[2-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]-3-(trifluoromethyl)benzamide (PubChem CID 3835196) has the molecular formula C18H9F9N4O
and a molecular weight of 468.28 g/mol. Its IUPAC name is N-[2-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]-3-(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | N-[2-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]-3-(trifluoromethyl)benzamide |
| PubChem CID | 3835196 |
| Molecular Formula | C18H9F9N4O |
| Molecular Weight | 468.28 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | N-[2-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cccnc1-n1nc(C(F)(F)F)cc1C(F)(F)F)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H9F9N4O/c19-16(20,21)10-4-1-3-9(7-10)15(32)29-11-5-2-6-28-14(11)31-13(18(25,26)27)8-12(30-31)17(22,23)24/h1-8H,(H,29,32) |
| InChIKey | JWNJFRWJLQKLOY-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.28 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]-3-(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]-3-(trifluoromethyl)benzamide?
The IUPAC name of N-[2-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]-3-(trifluoromethyl)benzamide (CID 3835196) is N-[2-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]-3-(trifluoromethyl)benzamide.
What is the SMILES notation for N-[2-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]-3-(trifluoromethyl)benzamide?
The canonical SMILES for N-[2-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]-3-(trifluoromethyl)benzamide is O=C(Nc1cccnc1-n1nc(C(F)(F)F)cc1C(F)(F)F)c1cccc(C(F)(F)F)c1.
What is the InChIKey of N-[2-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]-3-(trifluoromethyl)benzamide?
The InChIKey is JWNJFRWJLQKLOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H9F9N4O/c19-16(20,21)10-4-1-3-9(7-10)15(32)29-11-5-2-6-28-14(11)31-13(18(25,26)27)8-12(30-31)17(22,23)24/h1-8H,(H,29,32).
What are the key properties of N-[2-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]-3-(trifluoromethyl)benzamide?
N-[2-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]-3-(trifluoromethyl)benzamide has a molecular weight of 468.28 g/mol, XLogP of 5.58, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]-3-(trifluoromethyl)benzamide is sourced from PubChem (CID 3835196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).