C19H33N3O5 — CID 38353693
(2R,5S,8S)-5-methyl-2,8-bis(2-methylpropyl)-1-oxa-4,7,10-triazacyclotetradecane-3,6,9,14-tetrone (PubChem CID 38353693) has the molecular formula C19H33N3O5 and a molecular weight of 383.49 g/mol. Its IUPAC name is (2R,5S,8S)-5-methyl-2,8-bis(2-methylpropyl)-1-oxa-4,7,10-triazacyclotetradecane-3,6,9,14-tetrone.
| Compound Name | (2R,5S,8S)-5-methyl-2,8-bis(2-methylpropyl)-1-oxa-4,7,10-triazacyclotetradecane-3,6,9,14-tetrone |
|---|---|
| PubChem CID | 38353693 |
| Molecular Formula | C19H33N3O5 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | (2R,5S,8S)-5-methyl-2,8-bis(2-methylpropyl)-1-oxa-4,7,10-triazacyclotetradecane-3,6,9,14-tetrone |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@H](C)NC(=O)[C@@H](CC(C)C)OC(=O)CCCNC1=O |
| InChI | InChI=1S/C19H33N3O5/c1-11(2)9-14-18(25)20-8-6-7-16(23)27-15(10-12(3)4)19(26)21-13(5)17(24)22-14/h11-15H,6-10H2,1-5H3,(H,20,25)(H,21,26)(H,22,24)/t13-,14-,15+/m0/s1 |
| InChIKey | QWWUZAJFCIZIIQ-SOUVJXGZSA-N |
| XLogP | 0.89 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |