About Edmba
Edmba (PubChem CID 38354) has the molecular formula C20H16O
and a molecular weight of 272.30 g/mol. Its IUPAC name is 12,19-dimethyl-3-oxapentacyclo[9.8.0.02,4.05,10.013,18]nonadeca-1(19),5,7,9,11,13,15,17-octaene.
Molecular Properties
| Compound Name | Edmba |
| PubChem CID | 38354 |
| Molecular Formula | C20H16O |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 12,19-dimethyl-3-oxapentacyclo[9.8.0.02,4.05,10.013,18]nonadeca-1(19),5,7,9,11,13,15,17-octaene |
| SMILES | CC1=C2C3C(O3)C4=CC=CC=C4C2=C(C5=CC=CC=C15)C |
| InChI | InChI=1S/C20H16O/c1-11-13-7-3-4-8-14(13)12(2)18-17(11)15-9-5-6-10-16(15)19-20(18)21-19/h3-10,19-20H,1-2H3 |
| InChIKey | HVGNLIKFFBYBQM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | 418 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze Edmba with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Edmba?
The IUPAC name of Edmba (CID 38354) is 12,19-dimethyl-3-oxapentacyclo[9.8.0.02,4.05,10.013,18]nonadeca-1(19),5,7,9,11,13,15,17-octaene.
What is the SMILES notation for Edmba?
The canonical SMILES for Edmba is CC1=C2C3C(O3)C4=CC=CC=C4C2=C(C5=CC=CC=C15)C.
What is the InChIKey of Edmba?
The InChIKey is HVGNLIKFFBYBQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16O/c1-11-13-7-3-4-8-14(13)12(2)18-17(11)15-9-5-6-10-16(15)19-20(18)21-19/h3-10,19-20H,1-2H3.
What are the key properties of Edmba?
Edmba has a molecular weight of 272.30 g/mol, XLogP of 4.60, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Edmba is sourced from PubChem (CID 38354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).