C22H24N2O4S — CID 3835548
ethyl 3-[3-[(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 3835548) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is ethyl 3-[3-[(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | ethyl 3-[3-[(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 3835548 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | ethyl 3-[3-[(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-n2c(C)cc(C=C3SC(=O)N(C(C)C)C3=O)c2C)c1 |
| InChI | InChI=1S/C22H24N2O4S/c1-6-28-21(26)16-8-7-9-18(11-16)24-14(4)10-17(15(24)5)12-19-20(25)23(13(2)3)22(27)29-19/h7-13H,6H2,1-5H3 |
| InChIKey | ZHYVGXGGXOBUMF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|