About 2-(nitromethylidene)-1,3-thiazolidine
2-(nitromethylidene)-1,3-thiazolidine (PubChem CID 3835583) has the molecular formula C4H6N2O2S
and a molecular weight of 146.17 g/mol. Its IUPAC name is 2-(nitromethylidene)-1,3-thiazolidine.
Molecular Properties
| Compound Name | 2-(nitromethylidene)-1,3-thiazolidine |
| PubChem CID | 3835583 |
| Molecular Formula | C4H6N2O2S |
| Molecular Weight | 146.17 g/mol |
| Exact Mass | 146.01 |
| IUPAC Name | 2-(nitromethylidene)-1,3-thiazolidine |
| SMILES | O=[N+]([O-])C=C1NCCS1 |
| InChI | InChI=1S/C4H6N2O2S/c7-6(8)3-4-5-1-2-9-4/h3,5H,1-2H2 |
| InChIKey | IDEZECZCLMOIJN-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.17 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(nitromethylidene)-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(nitromethylidene)-1,3-thiazolidine?
The IUPAC name of 2-(nitromethylidene)-1,3-thiazolidine (CID 3835583) is 2-(nitromethylidene)-1,3-thiazolidine.
What is the SMILES notation for 2-(nitromethylidene)-1,3-thiazolidine?
The canonical SMILES for 2-(nitromethylidene)-1,3-thiazolidine is O=[N+]([O-])C=C1NCCS1.
What is the InChIKey of 2-(nitromethylidene)-1,3-thiazolidine?
The InChIKey is IDEZECZCLMOIJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O2S/c7-6(8)3-4-5-1-2-9-4/h3,5H,1-2H2.
What are the key properties of 2-(nitromethylidene)-1,3-thiazolidine?
2-(nitromethylidene)-1,3-thiazolidine has a molecular weight of 146.17 g/mol, XLogP of 0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(nitromethylidene)-1,3-thiazolidine is sourced from PubChem (CID 3835583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).