C25H26O8 — CID 38355837
methyl (2R)-3-(3,4-dihydroxyphenyl)-2-[[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]methyl]-4-methoxy-5-oxofuran-2-carboxylate (PubChem CID 38355837) has the molecular formula C25H26O8 and a molecular weight of 454.48 g/mol. Its IUPAC name is methyl (2R)-3-(3,4-dihydroxyphenyl)-2-[[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]methyl]-4-methoxy-5-oxofuran-2-carboxylate.
| Compound Name | methyl (2R)-3-(3,4-dihydroxyphenyl)-2-[[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]methyl]-4-methoxy-5-oxofuran-2-carboxylate |
|---|---|
| PubChem CID | 38355837 |
| Molecular Formula | C25H26O8 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | methyl (2R)-3-(3,4-dihydroxyphenyl)-2-[[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]methyl]-4-methoxy-5-oxofuran-2-carboxylate |
| SMILES | COC(=O)[C@]1(Cc2ccc(O)c(CC=C(C)C)c2)OC(=O)C(OC)=C1c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C25H26O8/c1-14(2)5-7-16-11-15(6-9-18(16)26)13-25(24(30)32-4)21(22(31-3)23(29)33-25)17-8-10-19(27)20(28)12-17/h5-6,8-12,26-28H,7,13H2,1-4H3/t25-/m1/s1 |
| InChIKey | ABJOCPBDVGJFLG-RUZDIDTESA-N |
| XLogP | 3.38 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|